C32H55N3O7S2 — CID 155048741
N-[3-[2-(tert-butyldisulfanyl)-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propanamide (PubChem CID 155048741) has the molecular formula C32H55N3O7S2 and a molecular weight of 657.94 g/mol. Its IUPAC name is N-[3-[2-(tert-butyldisulfanyl)-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propanamide.
| Compound Name | N-[3-[2-(tert-butyldisulfanyl)-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 155048741 |
| Molecular Formula | C32H55N3O7S2 |
| Molecular Weight | 657.94 g/mol |
| Exact Mass | 657.35 |
| IUPAC Name | N-[3-[2-(tert-butyldisulfanyl)-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propanamide |
| SMILES | CC(C)/C=C/CNC(=O)COCCOC(COc1cccc(NC(=O)CCOCCOCCNC(C)C)c1)SSC(C)(C)C |
| InChI | InChI=1S/C32H55N3O7S2/c1-25(2)10-9-14-34-30(37)23-40-20-21-41-31(43-44-32(5,6)7)24-42-28-12-8-11-27(22-28)35-29(36)13-16-38-18-19-39-17-15-33-26(3)4/h8-12,22,25-26,31,33H,13-21,23-24H2,1-7H3,(H,34,37)(H,35,36)/b10-9+ |
| InChIKey | KZFIOYAVIQRWOS-MDZDMXLPSA-N |
| XLogP | 5.29 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.94 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|