C15H22N2O4 — CID 63771165
2-[3-[4-(propan-2-ylamino)butanoylamino]phenoxy]acetic acid (PubChem CID 63771165) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2-[3-[4-(propan-2-ylamino)butanoylamino]phenoxy]acetic acid.
| Compound Name | 2-[3-[4-(propan-2-ylamino)butanoylamino]phenoxy]acetic acid |
|---|---|
| PubChem CID | 63771165 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[3-[4-(propan-2-ylamino)butanoylamino]phenoxy]acetic acid |
| SMILES | CC(C)NCCCC(=O)Nc1cccc(OCC(=O)O)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-11(2)16-8-4-7-14(18)17-12-5-3-6-13(9-12)21-10-15(19)20/h3,5-6,9,11,16H,4,7-8,10H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | NZPYLLHOGMLAEG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|