C16H24N2O3 — CID 115339859
3-[3-[4-(propan-2-ylamino)butanoylamino]phenyl]propanoic acid (PubChem CID 115339859) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 3-[3-[4-(propan-2-ylamino)butanoylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[4-(propan-2-ylamino)butanoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 115339859 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-[3-[4-(propan-2-ylamino)butanoylamino]phenyl]propanoic acid |
| SMILES | CC(C)NCCCC(=O)Nc1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C16H24N2O3/c1-12(2)17-10-4-7-15(19)18-14-6-3-5-13(11-14)8-9-16(20)21/h3,5-6,11-12,17H,4,7-10H2,1-2H3,(H,18,19)(H,20,21) |
| InChIKey | GTZOULMIKHNJPF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|