C28H46N6O7 — CID 155048689
N-[3-[2-azido-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propanamide (PubChem CID 155048689) has the molecular formula C28H46N6O7 and a molecular weight of 578.71 g/mol. Its IUPAC name is N-[3-[2-azido-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propanamide.
| Compound Name | N-[3-[2-azido-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 155048689 |
| Molecular Formula | C28H46N6O7 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | N-[3-[2-azido-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]propanamide |
| SMILES | CC(C)/C=C/CNC(=O)COCCOC(COc1cccc(NC(=O)CCOCCOCCNC(C)C)c1)N=[N+]=[N-] |
| InChI | InChI=1S/C28H46N6O7/c1-22(2)7-6-11-31-27(36)20-39-17-18-40-28(33-34-29)21-41-25-9-5-8-24(19-25)32-26(35)10-13-37-15-16-38-14-12-30-23(3)4/h5-9,19,22-23,28,30H,10-18,20-21H2,1-4H3,(H,31,36)(H,32,35)/b7-6+ |
| InChIKey | XKTPIAXVFGFFAT-VOTSOKGWSA-N |
| XLogP | 3.42 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|