C25H42N4O6 — CID 156841690
3-[2-amino-2-[2-[2-oxo-2-[2-[(E)-pent-2-enoxy]ethylamino]ethoxy]ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 156841690) has the molecular formula C25H42N4O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is 3-[2-amino-2-[2-[2-oxo-2-[2-[(E)-pent-2-enoxy]ethylamino]ethoxy]ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 3-[2-amino-2-[2-[2-oxo-2-[2-[(E)-pent-2-enoxy]ethylamino]ethoxy]ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 156841690 |
| Molecular Formula | C25H42N4O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 3-[2-amino-2-[2-[2-oxo-2-[2-[(E)-pent-2-enoxy]ethylamino]ethoxy]ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC/C=C/COCCNC(=O)COCCOC(N)COc1cccc(C(=O)NCCNC(C)C)c1 |
| InChI | InChI=1S/C25H42N4O6/c1-4-5-6-13-32-14-12-28-24(30)19-33-15-16-34-23(26)18-35-22-9-7-8-21(17-22)25(31)29-11-10-27-20(2)3/h5-9,17,20,23,27H,4,10-16,18-19,26H2,1-3H3,(H,28,30)(H,29,31)/b6-5+ |
| InChIKey | WJVVXKZADRGWEE-AATRIKPKSA-N |
| XLogP | 1.21 |
| TPSA | 133.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|