C25H40N6O8 — CID 155699447
N-[2-[(6-acetamido-2-formamidohexanoyl)amino]ethyl]-3-[2-amino-2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethoxy]benzamide (PubChem CID 155699447) has the molecular formula C25H40N6O8 and a molecular weight of 552.63 g/mol. Its IUPAC name is N-[2-[(6-acetamido-2-formamidohexanoyl)amino]ethyl]-3-[2-amino-2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethoxy]benzamide.
| Compound Name | N-[2-[(6-acetamido-2-formamidohexanoyl)amino]ethyl]-3-[2-amino-2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethoxy]benzamide |
|---|---|
| PubChem CID | 155699447 |
| Molecular Formula | C25H40N6O8 |
| Molecular Weight | 552.63 g/mol |
| Exact Mass | 552.29 |
| IUPAC Name | N-[2-[(6-acetamido-2-formamidohexanoyl)amino]ethyl]-3-[2-amino-2-[2-[2-(methylamino)-2-oxoethoxy]ethoxy]ethoxy]benzamide |
| SMILES | CNC(=O)COCCOC(N)COc1cccc(C(=O)NCCNC(=O)C(CCCCNC(C)=O)NC=O)c1 |
| InChI | InChI=1S/C25H40N6O8/c1-18(33)28-9-4-3-8-21(31-17-32)25(36)30-11-10-29-24(35)19-6-5-7-20(14-19)39-15-22(26)38-13-12-37-16-23(34)27-2/h5-7,14,17,21-22H,3-4,8-13,15-16,26H2,1-2H3,(H,27,34)(H,28,33)(H,29,35)(H,30,36)(H,31,32) |
| InChIKey | XUPCABPCGHZOJQ-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 199.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.63 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|