C19H31N3O5 — CID 153336638
3-[2-amino-2-[2-(2-oxopropoxy)ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 153336638) has the molecular formula C19H31N3O5 and a molecular weight of 381.47 g/mol. Its IUPAC name is 3-[2-amino-2-[2-(2-oxopropoxy)ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 3-[2-amino-2-[2-(2-oxopropoxy)ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 153336638 |
| Molecular Formula | C19H31N3O5 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 3-[2-amino-2-[2-(2-oxopropoxy)ethoxy]ethoxy]-N-[2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC(=O)COCCOC(N)COc1cccc(C(=O)NCCNC(C)C)c1 |
| InChI | InChI=1S/C19H31N3O5/c1-14(2)21-7-8-22-19(24)16-5-4-6-17(11-16)27-13-18(20)26-10-9-25-12-15(3)23/h4-6,11,14,18,21H,7-10,12-13,20H2,1-3H3,(H,22,24) |
| InChIKey | GWTKSKTWLFUJPS-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|