C19H28N4O5 — CID 153336620
3-[2-amino-2-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-(2-aminoethyl)benzamide (PubChem CID 153336620) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[2-amino-2-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-(2-aminoethyl)benzamide.
| Compound Name | 3-[2-amino-2-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-(2-aminoethyl)benzamide |
|---|---|
| PubChem CID | 153336620 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | 3-[2-amino-2-[2-[2-(but-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-(2-aminoethyl)benzamide |
| SMILES | CC#CCNC(=O)COCCOC(N)COc1cccc(C(=O)NCCN)c1 |
| InChI | InChI=1S/C19H28N4O5/c1-2-3-8-22-18(24)14-26-10-11-27-17(21)13-28-16-6-4-5-15(12-16)19(25)23-9-7-20/h4-6,12,17H,7-11,13-14,20-21H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | IHFMEGQLJNRDDN-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|