C30H48N4O8S — CID 154642859
N-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethyl]-3-[2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]propoxy]benzamide;thiocyanic acid (PubChem CID 154642859) has the molecular formula C30H48N4O8S and a molecular weight of 624.80 g/mol. Its IUPAC name is N-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethyl]-3-[2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]propoxy]benzamide;thiocyanic acid.
| Compound Name | N-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethyl]-3-[2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]propoxy]benzamide;thiocyanic acid |
|---|---|
| PubChem CID | 154642859 |
| Molecular Formula | C30H48N4O8S |
| Molecular Weight | 624.80 g/mol |
| Exact Mass | 624.32 |
| IUPAC Name | N-[2-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]ethyl]-3-[2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]propoxy]benzamide;thiocyanic acid |
| SMILES | CC(C)C#CCNC(=O)COCCOC(C)COc1cccc(C(=O)NCCOCCOCCOCCCN)c1.N#CS |
| InChI | InChI=1S/C29H47N3O8.CHNS/c1-24(2)7-5-11-31-28(33)23-38-19-20-39-25(3)22-40-27-9-4-8-26(21-27)29(34)32-12-14-36-16-18-37-17-15-35-13-6-10-30;2-1-3/h4,8-9,21,24-25H,6,10-20,22-23,30H2,1-3H3,(H,31,33)(H,32,34);3H |
| InChIKey | JLGOABKGRBOHIO-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 163.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.80 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|