C22H32N6O5 — CID 155048686
3-[2-azido-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide (PubChem CID 155048686) has the molecular formula C22H32N6O5 and a molecular weight of 460.54 g/mol. Its IUPAC name is 3-[2-azido-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide.
| Compound Name | 3-[2-azido-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 155048686 |
| Molecular Formula | C22H32N6O5 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 3-[2-azido-2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]ethoxy]-N-[2-(methylamino)ethyl]benzamide |
| SMILES | CNCCNC(=O)c1cccc(OCC(N=[N+]=[N-])OCCOCC(=O)NCC#CC(C)C)c1 |
| InChI | InChI=1S/C22H32N6O5/c1-17(2)6-5-9-25-20(29)15-31-12-13-32-21(27-28-23)16-33-19-8-4-7-18(14-19)22(30)26-11-10-24-3/h4,7-8,14,17,21,24H,9-13,15-16H2,1-3H3,(H,25,29)(H,26,30) |
| InChIKey | AACDJZOLRRQTNT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|