C30H47N5O7 — CID 168756251
3-[2-azido-2-[2-[2-[4-[2-(4-methylpent-2-ynoxy)ethylamino]-4-oxobutoxy]ethoxy]ethoxy]ethoxy]-N-(3-methylbutyl)benzamide (PubChem CID 168756251) has the molecular formula C30H47N5O7 and a molecular weight of 589.73 g/mol. Its IUPAC name is 3-[2-azido-2-[2-[2-[4-[2-(4-methylpent-2-ynoxy)ethylamino]-4-oxobutoxy]ethoxy]ethoxy]ethoxy]-N-(3-methylbutyl)benzamide.
| Compound Name | 3-[2-azido-2-[2-[2-[4-[2-(4-methylpent-2-ynoxy)ethylamino]-4-oxobutoxy]ethoxy]ethoxy]ethoxy]-N-(3-methylbutyl)benzamide |
|---|---|
| PubChem CID | 168756251 |
| Molecular Formula | C30H47N5O7 |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.35 |
| IUPAC Name | 3-[2-azido-2-[2-[2-[4-[2-(4-methylpent-2-ynoxy)ethylamino]-4-oxobutoxy]ethoxy]ethoxy]ethoxy]-N-(3-methylbutyl)benzamide |
| SMILES | CC(C)C#CCOCCNC(=O)CCCOCCOCCOC(COc1cccc(C(=O)NCCC(C)C)c1)N=[N+]=[N-] |
| InChI | InChI=1S/C30H47N5O7/c1-24(2)8-6-15-38-17-14-32-28(36)11-7-16-39-18-19-40-20-21-41-29(34-35-31)23-42-27-10-5-9-26(22-27)30(37)33-13-12-25(3)4/h5,9-10,22,24-25,29H,7,11-21,23H2,1-4H3,(H,32,36)(H,33,37) |
| InChIKey | HWABVVOMKVMCMC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|