C26H41N3O7S2 — CID 167473694
3-[2-(disulfanyl)-2-[2-[2-[4-oxo-4-(2-prop-2-ynoxyethylamino)butoxy]ethoxy]ethoxy]ethoxy]-N-[2-(ethylamino)ethyl]benzamide (PubChem CID 167473694) has the molecular formula C26H41N3O7S2 and a molecular weight of 571.76 g/mol. Its IUPAC name is 3-[2-(disulfanyl)-2-[2-[2-[4-oxo-4-(2-prop-2-ynoxyethylamino)butoxy]ethoxy]ethoxy]ethoxy]-N-[2-(ethylamino)ethyl]benzamide.
| Compound Name | 3-[2-(disulfanyl)-2-[2-[2-[4-oxo-4-(2-prop-2-ynoxyethylamino)butoxy]ethoxy]ethoxy]ethoxy]-N-[2-(ethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 167473694 |
| Molecular Formula | C26H41N3O7S2 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 3-[2-(disulfanyl)-2-[2-[2-[4-oxo-4-(2-prop-2-ynoxyethylamino)butoxy]ethoxy]ethoxy]ethoxy]-N-[2-(ethylamino)ethyl]benzamide |
| SMILES | C#CCOCCNC(=O)CCCOCCOCCOC(COc1cccc(C(=O)NCCNCC)c1)SS |
| InChI | InChI=1S/C26H41N3O7S2/c1-3-13-32-15-12-28-24(30)9-6-14-33-16-17-34-18-19-35-25(38-37)21-36-23-8-5-7-22(20-23)26(31)29-11-10-27-4-2/h1,5,7-8,20,25,27,37H,4,6,9-19,21H2,2H3,(H,28,30)(H,29,31) |
| InChIKey | HSHSXERQQHKWDM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|