C21H23BrN2O4 — CID 60615622
N-[2-[4-(3-acetylphenoxy)butanoylamino]ethyl]-3-bromobenzamide (PubChem CID 60615622) has the molecular formula C21H23BrN2O4 and a molecular weight of 447.33 g/mol. Its IUPAC name is N-[2-[4-(3-acetylphenoxy)butanoylamino]ethyl]-3-bromobenzamide.
| Compound Name | N-[2-[4-(3-acetylphenoxy)butanoylamino]ethyl]-3-bromobenzamide |
|---|---|
| PubChem CID | 60615622 |
| Molecular Formula | C21H23BrN2O4 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | N-[2-[4-(3-acetylphenoxy)butanoylamino]ethyl]-3-bromobenzamide |
| SMILES | CC(=O)c1cccc(OCCCC(=O)NCCNC(=O)c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C21H23BrN2O4/c1-15(25)16-5-3-8-19(14-16)28-12-4-9-20(26)23-10-11-24-21(27)17-6-2-7-18(22)13-17/h2-3,5-8,13-14H,4,9-12H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | CBNLEEHIVYTHFS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|