C14H17BrN2O3 — CID 108539699
3-bromo-N-[2-(4-oxopentanoylamino)ethyl]benzamide (PubChem CID 108539699) has the molecular formula C14H17BrN2O3 and a molecular weight of 341.21 g/mol. Its IUPAC name is 3-bromo-N-[2-(4-oxopentanoylamino)ethyl]benzamide.
| Compound Name | 3-bromo-N-[2-(4-oxopentanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 108539699 |
| Molecular Formula | C14H17BrN2O3 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 3-bromo-N-[2-(4-oxopentanoylamino)ethyl]benzamide |
| SMILES | CC(=O)CCC(=O)NCCNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H17BrN2O3/c1-10(18)5-6-13(19)16-7-8-17-14(20)11-3-2-4-12(15)9-11/h2-4,9H,5-8H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | QKGKECUJEVQNTJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|