C11H10BrF3N2O2 — CID 108537613
3-bromo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide (PubChem CID 108537613) has the molecular formula C11H10BrF3N2O2 and a molecular weight of 339.11 g/mol. Its IUPAC name is 3-bromo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide.
| Compound Name | 3-bromo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108537613 |
| Molecular Formula | C11H10BrF3N2O2 |
| Molecular Weight | 339.11 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 3-bromo-N-[2-[(2,2,2-trifluoroacetyl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)C(F)(F)F)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H10BrF3N2O2/c12-8-3-1-2-7(6-8)9(18)16-4-5-17-10(19)11(13,14)15/h1-3,6H,4-5H2,(H,16,18)(H,17,19) |
| InChIKey | URMHOFYCKZVUNB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.11 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|