C17H15Br2FN2O2 — CID 60622543
4-bromo-N-[3-[(3-bromobenzoyl)amino]propyl]-3-fluorobenzamide (PubChem CID 60622543) has the molecular formula C17H15Br2FN2O2 and a molecular weight of 458.13 g/mol. Its IUPAC name is 4-bromo-N-[3-[(3-bromobenzoyl)amino]propyl]-3-fluorobenzamide.
| Compound Name | 4-bromo-N-[3-[(3-bromobenzoyl)amino]propyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 60622543 |
| Molecular Formula | C17H15Br2FN2O2 |
| Molecular Weight | 458.13 g/mol |
| Exact Mass | 455.95 |
| IUPAC Name | 4-bromo-N-[3-[(3-bromobenzoyl)amino]propyl]-3-fluorobenzamide |
| SMILES | O=C(NCCCNC(=O)c1ccc(Br)c(F)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H15Br2FN2O2/c18-13-4-1-3-11(9-13)16(23)21-7-2-8-22-17(24)12-5-6-14(19)15(20)10-12/h1,3-6,9-10H,2,7-8H2,(H,21,23)(H,22,24) |
| InChIKey | OAWKEMPAYRZWMY-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.13 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|