C19H19Br2FN2O2 — CID 60622420
3-bromo-N-[3-[3-(4-bromo-2-fluorophenyl)propanoylamino]propyl]benzamide (PubChem CID 60622420) has the molecular formula C19H19Br2FN2O2 and a molecular weight of 486.18 g/mol. Its IUPAC name is 3-bromo-N-[3-[3-(4-bromo-2-fluorophenyl)propanoylamino]propyl]benzamide.
| Compound Name | 3-bromo-N-[3-[3-(4-bromo-2-fluorophenyl)propanoylamino]propyl]benzamide |
|---|---|
| PubChem CID | 60622420 |
| Molecular Formula | C19H19Br2FN2O2 |
| Molecular Weight | 486.18 g/mol |
| Exact Mass | 483.98 |
| IUPAC Name | 3-bromo-N-[3-[3-(4-bromo-2-fluorophenyl)propanoylamino]propyl]benzamide |
| SMILES | O=C(CCc1ccc(Br)cc1F)NCCCNC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H19Br2FN2O2/c20-15-4-1-3-14(11-15)19(26)24-10-2-9-23-18(25)8-6-13-5-7-16(21)12-17(13)22/h1,3-5,7,11-12H,2,6,8-10H2,(H,23,25)(H,24,26) |
| InChIKey | WZFIPCCOXKVRSX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.18 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|