C15H16BrFN2O2 — CID 49206881
3-(4-bromo-2-fluorophenyl)-N-[3-oxo-3-(prop-2-ynylamino)propyl]propanamide (PubChem CID 49206881) has the molecular formula C15H16BrFN2O2 and a molecular weight of 355.21 g/mol. Its IUPAC name is 3-(4-bromo-2-fluorophenyl)-N-[3-oxo-3-(prop-2-ynylamino)propyl]propanamide.
| Compound Name | 3-(4-bromo-2-fluorophenyl)-N-[3-oxo-3-(prop-2-ynylamino)propyl]propanamide |
|---|---|
| PubChem CID | 49206881 |
| Molecular Formula | C15H16BrFN2O2 |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 3-(4-bromo-2-fluorophenyl)-N-[3-oxo-3-(prop-2-ynylamino)propyl]propanamide |
| SMILES | C#CCNC(=O)CCNC(=O)CCc1ccc(Br)cc1F |
| InChI | InChI=1S/C15H16BrFN2O2/c1-2-8-18-15(21)7-9-19-14(20)6-4-11-3-5-12(16)10-13(11)17/h1,3,5,10H,4,6-9H2,(H,18,21)(H,19,20) |
| InChIKey | QRBFLBCBFFEZFB-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|