C27H42N4O7S — CID 155257579
[(1S)-2-[3-[3-[2-[2-(methylamino)ethoxy]ethoxy]propanoylamino]phenoxy]-1-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethyl] thiocyanate (PubChem CID 155257579) has the molecular formula C27H42N4O7S and a molecular weight of 566.72 g/mol. Its IUPAC name is [(1S)-2-[3-[3-[2-[2-(methylamino)ethoxy]ethoxy]propanoylamino]phenoxy]-1-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethyl] thiocyanate.
| Compound Name | [(1S)-2-[3-[3-[2-[2-(methylamino)ethoxy]ethoxy]propanoylamino]phenoxy]-1-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethyl] thiocyanate |
|---|---|
| PubChem CID | 155257579 |
| Molecular Formula | C27H42N4O7S |
| Molecular Weight | 566.72 g/mol |
| Exact Mass | 566.28 |
| IUPAC Name | [(1S)-2-[3-[3-[2-[2-(methylamino)ethoxy]ethoxy]propanoylamino]phenoxy]-1-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethyl] thiocyanate |
| SMILES | CNCCOCCOCCC(=O)Nc1cccc(OC[C@@H](OCCOCC(=O)NC/C=C/C(C)C)SC#N)c1 |
| InChI | InChI=1S/C27H42N4O7S/c1-22(2)6-5-10-30-26(33)19-36-16-17-37-27(39-21-28)20-38-24-8-4-7-23(18-24)31-25(32)9-12-34-14-15-35-13-11-29-3/h4-8,18,22,27,29H,9-17,19-20H2,1-3H3,(H,30,33)(H,31,32)/b6-5+/t27-/m0/s1 |
| InChIKey | PLIVEWUSKBUPNM-BLRKDVCKSA-N |
| XLogP | 2.55 |
| TPSA | 140.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.72 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|