C29H52N2O4 — CID 155048781
3-[2-[2-(ethylamino)ethoxy]ethoxy]-N-[3-(2-hexyloctoxy)phenyl]propanamide (PubChem CID 155048781) has the molecular formula C29H52N2O4 and a molecular weight of 492.75 g/mol. Its IUPAC name is 3-[2-[2-(ethylamino)ethoxy]ethoxy]-N-[3-(2-hexyloctoxy)phenyl]propanamide.
| Compound Name | 3-[2-[2-(ethylamino)ethoxy]ethoxy]-N-[3-(2-hexyloctoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 155048781 |
| Molecular Formula | C29H52N2O4 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.39 |
| IUPAC Name | 3-[2-[2-(ethylamino)ethoxy]ethoxy]-N-[3-(2-hexyloctoxy)phenyl]propanamide |
| SMILES | CCCCCCC(CCCCCC)COc1cccc(NC(=O)CCOCCOCCNCC)c1 |
| InChI | InChI=1S/C29H52N2O4/c1-4-7-9-11-14-26(15-12-10-8-5-2)25-35-28-17-13-16-27(24-28)31-29(32)18-20-33-22-23-34-21-19-30-6-3/h13,16-17,24,26,30H,4-12,14-15,18-23,25H2,1-3H3,(H,31,32) |
| InChIKey | MJJHDHDDPIGDJT-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|