C27H44N6O7 — CID 155048765
N-[3-[2-azido-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(ethylamino)ethoxy]ethoxy]propanamide (PubChem CID 155048765) has the molecular formula C27H44N6O7 and a molecular weight of 564.68 g/mol. Its IUPAC name is N-[3-[2-azido-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(ethylamino)ethoxy]ethoxy]propanamide.
| Compound Name | N-[3-[2-azido-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(ethylamino)ethoxy]ethoxy]propanamide |
|---|---|
| PubChem CID | 155048765 |
| Molecular Formula | C27H44N6O7 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | N-[3-[2-azido-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]-3-[2-[2-(ethylamino)ethoxy]ethoxy]propanamide |
| SMILES | CCNCCOCCOCCC(=O)Nc1cccc(OCC(N=[N+]=[N-])OCCOCC(=O)NC/C=C/C(C)C)c1 |
| InChI | InChI=1S/C27H44N6O7/c1-4-29-12-14-37-16-15-36-13-10-25(34)31-23-8-5-9-24(19-23)40-21-27(32-33-28)39-18-17-38-20-26(35)30-11-6-7-22(2)3/h5-9,19,22,27,29H,4,10-18,20-21H2,1-3H3,(H,30,35)(H,31,34)/b7-6+ |
| InChIKey | TWWTXRIGHIDERA-VOTSOKGWSA-N |
| XLogP | 3.03 |
| TPSA | 165.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|