C27H45N3O7S2 — CID 155048586
3-[2-[2-(methylamino)ethoxy]ethoxy]-N-[3-[2-(methyldisulfanyl)-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]propanamide (PubChem CID 155048586) has the molecular formula C27H45N3O7S2 and a molecular weight of 587.81 g/mol. Its IUPAC name is 3-[2-[2-(methylamino)ethoxy]ethoxy]-N-[3-[2-(methyldisulfanyl)-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]propanamide.
| Compound Name | 3-[2-[2-(methylamino)ethoxy]ethoxy]-N-[3-[2-(methyldisulfanyl)-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 155048586 |
| Molecular Formula | C27H45N3O7S2 |
| Molecular Weight | 587.81 g/mol |
| Exact Mass | 587.27 |
| IUPAC Name | 3-[2-[2-(methylamino)ethoxy]ethoxy]-N-[3-[2-(methyldisulfanyl)-2-[2-[2-[[(E)-4-methylpent-2-enyl]amino]-2-oxoethoxy]ethoxy]ethoxy]phenyl]propanamide |
| SMILES | CNCCOCCOCCC(=O)Nc1cccc(OCC(OCCOCC(=O)NC/C=C/C(C)C)SSC)c1 |
| InChI | InChI=1S/C27H45N3O7S2/c1-22(2)7-6-11-29-26(32)20-35-17-18-36-27(39-38-4)21-37-24-9-5-8-23(19-24)30-25(31)10-13-33-15-16-34-14-12-28-3/h5-9,19,22,27-28H,10-18,20-21H2,1-4H3,(H,29,32)(H,30,31)/b7-6+ |
| InChIKey | IXOGLJOMOCOTIA-VOTSOKGWSA-N |
| XLogP | 3.35 |
| TPSA | 116.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.81 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|