C28H56N2O6S2 — CID 154619326
3-[2-[2-[(2R)-2-(tert-butyldisulfanyl)-4-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-yl]oxyethoxy]ethoxy]-N-[(E)-4-methylpent-2-enyl]propanamide (PubChem CID 154619326) has the molecular formula C28H56N2O6S2 and a molecular weight of 580.90 g/mol. Its IUPAC name is 3-[2-[2-[(2R)-2-(tert-butyldisulfanyl)-4-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-yl]oxyethoxy]ethoxy]-N-[(E)-4-methylpent-2-enyl]propanamide.
| Compound Name | 3-[2-[2-[(2R)-2-(tert-butyldisulfanyl)-4-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-yl]oxyethoxy]ethoxy]-N-[(E)-4-methylpent-2-enyl]propanamide |
|---|---|
| PubChem CID | 154619326 |
| Molecular Formula | C28H56N2O6S2 |
| Molecular Weight | 580.90 g/mol |
| Exact Mass | 580.36 |
| IUPAC Name | 3-[2-[2-[(2R)-2-(tert-butyldisulfanyl)-4-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-yl]oxyethoxy]ethoxy]-N-[(E)-4-methylpent-2-enyl]propanamide |
| SMILES | CC(C)/C=C/CNC(=O)CCOCCOCCO[C@@](C)(CCOCCOCCNC(C)C)SSC(C)(C)C |
| InChI | InChI=1S/C28H56N2O6S2/c1-24(2)10-9-13-30-26(31)11-15-32-18-21-35-22-23-36-28(8,38-37-27(5,6)7)12-16-33-19-20-34-17-14-29-25(3)4/h9-10,24-25,29H,11-23H2,1-8H3,(H,30,31)/b10-9+/t28-/m1/s1 |
| InChIKey | RYCXLIPLCNESFW-AXJYFYFYSA-N |
| XLogP | 5.07 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|