C25H45N3O6S — CID 166562559
[2-[2-[2-[3-(4-methylpent-2-ynylamino)-3-oxopropoxy]ethoxy]ethoxy]-4-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-yl] thiocyanate (PubChem CID 166562559) has the molecular formula C25H45N3O6S and a molecular weight of 515.72 g/mol. Its IUPAC name is [2-[2-[2-[3-(4-methylpent-2-ynylamino)-3-oxopropoxy]ethoxy]ethoxy]-4-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-yl] thiocyanate.
| Compound Name | [2-[2-[2-[3-(4-methylpent-2-ynylamino)-3-oxopropoxy]ethoxy]ethoxy]-4-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-yl] thiocyanate |
|---|---|
| PubChem CID | 166562559 |
| Molecular Formula | C25H45N3O6S |
| Molecular Weight | 515.72 g/mol |
| Exact Mass | 515.30 |
| IUPAC Name | [2-[2-[2-[3-(4-methylpent-2-ynylamino)-3-oxopropoxy]ethoxy]ethoxy]-4-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]butan-2-yl] thiocyanate |
| SMILES | CC(C)C#CCNC(=O)CCOCCOCCOC(C)(CCOCCOCCNC(C)C)SC#N |
| InChI | InChI=1S/C25H45N3O6S/c1-22(2)7-6-10-28-24(29)8-12-30-15-18-33-19-20-34-25(5,35-21-26)9-13-31-16-17-32-14-11-27-23(3)4/h22-23,27H,8-20H2,1-5H3,(H,28,29) |
| InChIKey | NZBKQFFXPJRZSP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.72 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|