C20H38N2O4S2 — CID 167053736
3-[2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]-N-(4-methylpent-2-ynyl)propanamide (PubChem CID 167053736) has the molecular formula C20H38N2O4S2 and a molecular weight of 434.67 g/mol. Its IUPAC name is 3-[2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]-N-(4-methylpent-2-ynyl)propanamide.
| Compound Name | 3-[2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]-N-(4-methylpent-2-ynyl)propanamide |
|---|---|
| PubChem CID | 167053736 |
| Molecular Formula | C20H38N2O4S2 |
| Molecular Weight | 434.67 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 3-[2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]-N-(4-methylpent-2-ynyl)propanamide |
| SMILES | CNCCSSC(OCCOCCOCCC(=O)NCC#CC(C)C)C(C)C |
| InChI | InChI=1S/C20H38N2O4S2/c1-17(2)7-6-9-22-19(23)8-11-24-12-13-25-14-15-26-20(18(3)4)28-27-16-10-21-5/h17-18,20-21H,8-16H2,1-5H3,(H,22,23) |
| InChIKey | AJRDCJVQVKIXMP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.67 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|