C17H32N2O3S2 — CID 169266816
2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide (PubChem CID 169266816) has the molecular formula C17H32N2O3S2 and a molecular weight of 376.59 g/mol. Its IUPAC name is 2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide.
| Compound Name | 2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide |
|---|---|
| PubChem CID | 169266816 |
| Molecular Formula | C17H32N2O3S2 |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide |
| SMILES | CNCCSSC(OCCOCC(=O)NCC#CC(C)C)C(C)C |
| InChI | InChI=1S/C17H32N2O3S2/c1-14(2)7-6-8-19-16(20)13-21-10-11-22-17(15(3)4)24-23-12-9-18-5/h14-15,17-18H,8-13H2,1-5H3,(H,19,20) |
| InChIKey | SRTGEJMHCKTILX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|