C22H46N2O4S2 — CID 163281743
N-(4-methylpent-2-ynyl)-3-[2-[2-[2-methyl-1-[2-(propan-2-ylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]propanamide;molecular hydrogen (PubChem CID 163281743) has the molecular formula C22H46N2O4S2 and a molecular weight of 466.75 g/mol. Its IUPAC name is N-(4-methylpent-2-ynyl)-3-[2-[2-[2-methyl-1-[2-(propan-2-ylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]propanamide;molecular hydrogen.
| Compound Name | N-(4-methylpent-2-ynyl)-3-[2-[2-[2-methyl-1-[2-(propan-2-ylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 163281743 |
| Molecular Formula | C22H46N2O4S2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | N-(4-methylpent-2-ynyl)-3-[2-[2-[2-methyl-1-[2-(propan-2-ylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]propanamide;molecular hydrogen |
| SMILES | CC(C)C#CCNC(=O)CCOCCOCCOC(SSCCNC(C)C)C(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C22H42N2O4S2.2H2/c1-18(2)8-7-10-24-21(25)9-12-26-13-14-27-15-16-28-22(19(3)4)30-29-17-11-23-20(5)6;;/h18-20,22-23H,9-17H2,1-6H3,(H,24,25);2*1H |
| InChIKey | FBRIBUBPGXXNKN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|