C17H36N2O3S2 — CID 169266815
2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide;molecular hydrogen (PubChem CID 169266815) has the molecular formula C17H36N2O3S2 and a molecular weight of 380.62 g/mol. Its IUPAC name is 2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide;molecular hydrogen.
| Compound Name | 2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 169266815 |
| Molecular Formula | C17H36N2O3S2 |
| Molecular Weight | 380.62 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-[2-[2-methyl-1-[2-(methylamino)ethyldisulfanyl]propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide;molecular hydrogen |
| SMILES | CNCCSSC(OCCOCC(=O)NCC#CC(C)C)C(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C17H32N2O3S2.2H2/c1-14(2)7-6-8-19-16(20)13-21-10-11-22-17(15(3)4)24-23-12-9-18-5;;/h14-15,17-18H,8-13H2,1-5H3,(H,19,20);2*1H |
| InChIKey | WUVZOXVWEKQXNC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.62 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|