C21H40N2O4S2 — CID 169266997
3-[2-[2-[2-methyl-1-[2-(propan-2-ylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]-N-pent-2-ynylpropanamide (PubChem CID 169266997) has the molecular formula C21H40N2O4S2 and a molecular weight of 448.70 g/mol. Its IUPAC name is 3-[2-[2-[2-methyl-1-[2-(propan-2-ylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]-N-pent-2-ynylpropanamide.
| Compound Name | 3-[2-[2-[2-methyl-1-[2-(propan-2-ylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]-N-pent-2-ynylpropanamide |
|---|---|
| PubChem CID | 169266997 |
| Molecular Formula | C21H40N2O4S2 |
| Molecular Weight | 448.70 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 3-[2-[2-[2-methyl-1-[2-(propan-2-ylamino)ethyldisulfanyl]propoxy]ethoxy]ethoxy]-N-pent-2-ynylpropanamide |
| SMILES | CCC#CCNC(=O)CCOCCOCCOC(SSCCNC(C)C)C(C)C |
| InChI | InChI=1S/C21H40N2O4S2/c1-6-7-8-10-23-20(24)9-12-25-13-14-26-15-16-27-21(18(2)3)29-28-17-11-22-19(4)5/h18-19,21-22H,6,9-17H2,1-5H3,(H,23,24) |
| InChIKey | GQFFRAFBCDQQQL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|