C20H43N3O5 — CID 168959857
3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-[3-(propylamino)propyl]propanamide (PubChem CID 168959857) has the molecular formula C20H43N3O5 and a molecular weight of 405.58 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-[3-(propylamino)propyl]propanamide.
| Compound Name | 3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-[3-(propylamino)propyl]propanamide |
|---|---|
| PubChem CID | 168959857 |
| Molecular Formula | C20H43N3O5 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.32 |
| IUPAC Name | 3-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-[3-(propylamino)propyl]propanamide |
| SMILES | CCCNCCCNC(=O)CCOCCOCCOCCOCCNC(C)C |
| InChI | InChI=1S/C20H43N3O5/c1-4-7-21-8-5-9-23-20(24)6-11-25-13-15-27-17-18-28-16-14-26-12-10-22-19(2)3/h19,21-22H,4-18H2,1-3H3,(H,23,24) |
| InChIKey | YKVBCMCHFRPKPY-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|