C18H37N3O5S — CID 167310634
N-[2-[2-[2-[3-oxo-3-[2-(propan-2-ylamino)ethylamino]propoxy]ethoxy]ethoxy]ethyl]-3-sulfanylbutanamide (PubChem CID 167310634) has the molecular formula C18H37N3O5S and a molecular weight of 407.58 g/mol. Its IUPAC name is N-[2-[2-[2-[3-oxo-3-[2-(propan-2-ylamino)ethylamino]propoxy]ethoxy]ethoxy]ethyl]-3-sulfanylbutanamide.
| Compound Name | N-[2-[2-[2-[3-oxo-3-[2-(propan-2-ylamino)ethylamino]propoxy]ethoxy]ethoxy]ethyl]-3-sulfanylbutanamide |
|---|---|
| PubChem CID | 167310634 |
| Molecular Formula | C18H37N3O5S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.25 |
| IUPAC Name | N-[2-[2-[2-[3-oxo-3-[2-(propan-2-ylamino)ethylamino]propoxy]ethoxy]ethoxy]ethyl]-3-sulfanylbutanamide |
| SMILES | CC(S)CC(=O)NCCOCCOCCOCCC(=O)NCCNC(C)C |
| InChI | InChI=1S/C18H37N3O5S/c1-15(2)19-5-6-20-17(22)4-8-24-10-12-26-13-11-25-9-7-21-18(23)14-16(3)27/h15-16,19,27H,4-14H2,1-3H3,(H,20,22)(H,21,23) |
| InChIKey | QFCAIVDIUOQYGI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|