C13H24NO3S2U- — CID 169267046
ethane;N-pent-2-ynyl-2-[2-(1-sulfidosulfanylethoxy)ethoxy]acetamide;uranium (PubChem CID 169267046) has the molecular formula C13H24NO3S2U- and a molecular weight of 544.50 g/mol. Its IUPAC name is ethane;N-pent-2-ynyl-2-[2-(1-sulfidosulfanylethoxy)ethoxy]acetamide;uranium.
| Compound Name | ethane;N-pent-2-ynyl-2-[2-(1-sulfidosulfanylethoxy)ethoxy]acetamide;uranium |
|---|---|
| PubChem CID | 169267046 |
| Molecular Formula | C13H24NO3S2U- |
| Molecular Weight | 544.50 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | ethane;N-pent-2-ynyl-2-[2-(1-sulfidosulfanylethoxy)ethoxy]acetamide;uranium |
| SMILES | CC.CCC#CCNC(=O)COCCOC(C)S[S-].[U] |
| InChI | InChI=1S/C11H19NO3S2.C2H6.U/c1-3-4-5-6-12-11(13)9-14-7-8-15-10(2)17-16;1-2;/h10,16H,3,6-9H2,1-2H3,(H,12,13);1-2H3;/p-1 |
| InChIKey | UOXPYNDKMOZWTQ-UHFFFAOYSA-M |
| XLogP | 2.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|