C14H25N3O3S2 — CID 169267101
ethane;2-[2-[(6-methyl-3,6-dihydro-1,2,4,5-dithiadiazin-3-yl)oxy]ethoxy]-N-pent-2-ynylacetamide (PubChem CID 169267101) has the molecular formula C14H25N3O3S2 and a molecular weight of 347.51 g/mol. Its IUPAC name is ethane;2-[2-[(6-methyl-3,6-dihydro-1,2,4,5-dithiadiazin-3-yl)oxy]ethoxy]-N-pent-2-ynylacetamide.
| Compound Name | ethane;2-[2-[(6-methyl-3,6-dihydro-1,2,4,5-dithiadiazin-3-yl)oxy]ethoxy]-N-pent-2-ynylacetamide |
|---|---|
| PubChem CID | 169267101 |
| Molecular Formula | C14H25N3O3S2 |
| Molecular Weight | 347.51 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | ethane;2-[2-[(6-methyl-3,6-dihydro-1,2,4,5-dithiadiazin-3-yl)oxy]ethoxy]-N-pent-2-ynylacetamide |
| SMILES | CC.CCC#CCNC(=O)COCCOC1N=NC(C)SS1 |
| InChI | InChI=1S/C12H19N3O3S2.C2H6/c1-3-4-5-6-13-11(16)9-17-7-8-18-12-15-14-10(2)19-20-12;1-2/h10,12H,3,6-9H2,1-2H3,(H,13,16);1-2H3 |
| InChIKey | TXUYLLQJKVDDAQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|