About ethane;N-pent-2-ynylpropanamide
ethane;N-pent-2-ynylpropanamide (PubChem CID 169175409) has the molecular formula C10H19NO
and a molecular weight of 169.27 g/mol. Its IUPAC name is ethane;N-pent-2-ynylpropanamide.
Molecular Properties
| Compound Name | ethane;N-pent-2-ynylpropanamide |
| PubChem CID | 169175409 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | ethane;N-pent-2-ynylpropanamide |
| SMILES | CC.CCC#CCNC(=O)CC |
| InChI | InChI=1S/C8H13NO.C2H6/c1-3-5-6-7-9-8(10)4-2;1-2/h3-4,7H2,1-2H3,(H,9,10);1-2H3 |
| InChIKey | QMZVKIXQSIBRBQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-pent-2-ynylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-pent-2-ynylpropanamide?
The IUPAC name of ethane;N-pent-2-ynylpropanamide (CID 169175409) is ethane;N-pent-2-ynylpropanamide.
What is the SMILES notation for ethane;N-pent-2-ynylpropanamide?
The canonical SMILES for ethane;N-pent-2-ynylpropanamide is CC.CCC#CCNC(=O)CC.
What is the InChIKey of ethane;N-pent-2-ynylpropanamide?
The InChIKey is QMZVKIXQSIBRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO.C2H6/c1-3-5-6-7-9-8(10)4-2;1-2/h3-4,7H2,1-2H3,(H,9,10);1-2H3.
What are the key properties of ethane;N-pent-2-ynylpropanamide?
ethane;N-pent-2-ynylpropanamide has a molecular weight of 169.27 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-pent-2-ynylpropanamide is sourced from PubChem (CID 169175409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).