C9H11NO2 — CID 25140231
N-(6-hydroxyhexa-2,4-diynyl)propanamide (PubChem CID 25140231) has the molecular formula C9H11NO2 and a molecular weight of 165.19 g/mol. Its IUPAC name is N-(6-hydroxyhexa-2,4-diynyl)propanamide.
| Compound Name | N-(6-hydroxyhexa-2,4-diynyl)propanamide |
|---|---|
| PubChem CID | 25140231 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | N-(6-hydroxyhexa-2,4-diynyl)propanamide |
| SMILES | CCC(=O)NCC#CC#CCO |
| InChI | InChI=1S/C9H11NO2/c1-2-9(12)10-7-5-3-4-6-8-11/h11H,2,7-8H2,1H3,(H,10,12) |
| InChIKey | GGNCEIWOOCVGNA-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|