C19H29NO3S2 — CID 169266934
2-[2-[[4,5-bis(ethenyl)-6-methyl-3,6-dihydrodithiin-3-yl]oxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide;molecular hydrogen (PubChem CID 169266934) has the molecular formula C19H29NO3S2 and a molecular weight of 383.58 g/mol. Its IUPAC name is 2-[2-[[4,5-bis(ethenyl)-6-methyl-3,6-dihydrodithiin-3-yl]oxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide;molecular hydrogen.
| Compound Name | 2-[2-[[4,5-bis(ethenyl)-6-methyl-3,6-dihydrodithiin-3-yl]oxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 169266934 |
| Molecular Formula | C19H29NO3S2 |
| Molecular Weight | 383.58 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 2-[2-[[4,5-bis(ethenyl)-6-methyl-3,6-dihydrodithiin-3-yl]oxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide;molecular hydrogen |
| SMILES | C=CC1=C(C=C)C(OCCOCC(=O)NCC#CC(C)C)SSC1C.[H][H] |
| InChI | InChI=1S/C19H27NO3S2.H2/c1-6-16-15(5)24-25-19(17(16)7-2)23-12-11-22-13-18(21)20-10-8-9-14(3)4;/h6-7,14-15,19H,1-2,10-13H2,3-5H3,(H,20,21);1H |
| InChIKey | CLBMQFOZFZXBIQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|