C16H26N2O4S2 — CID 166807132
N-[2-[2-[2-oxo-2-(pent-2-ynylamino)ethoxy]ethoxymethyldisulfanyl]propyl]prop-2-enamide (PubChem CID 166807132) has the molecular formula C16H26N2O4S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is N-[2-[2-[2-oxo-2-(pent-2-ynylamino)ethoxy]ethoxymethyldisulfanyl]propyl]prop-2-enamide.
| Compound Name | N-[2-[2-[2-oxo-2-(pent-2-ynylamino)ethoxy]ethoxymethyldisulfanyl]propyl]prop-2-enamide |
|---|---|
| PubChem CID | 166807132 |
| Molecular Formula | C16H26N2O4S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-[2-[2-[2-oxo-2-(pent-2-ynylamino)ethoxy]ethoxymethyldisulfanyl]propyl]prop-2-enamide |
| SMILES | C=CC(=O)NCC(C)SSCOCCOCC(=O)NCC#CCC |
| InChI | InChI=1S/C16H26N2O4S2/c1-4-6-7-8-17-16(20)12-21-9-10-22-13-23-24-14(3)11-18-15(19)5-2/h5,14H,2,4,8-13H2,1,3H3,(H,17,20)(H,18,19) |
| InChIKey | YSPDWUBRFWGGIJ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|