C16H28N2O4S2 — CID 166807172
2-methyl-N-[[1-[2-[2-oxo-2-(pent-2-ynylamino)ethoxy]ethoxy]ethyldisulfanyl]methyl]propanamide (PubChem CID 166807172) has the molecular formula C16H28N2O4S2 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-methyl-N-[[1-[2-[2-oxo-2-(pent-2-ynylamino)ethoxy]ethoxy]ethyldisulfanyl]methyl]propanamide.
| Compound Name | 2-methyl-N-[[1-[2-[2-oxo-2-(pent-2-ynylamino)ethoxy]ethoxy]ethyldisulfanyl]methyl]propanamide |
|---|---|
| PubChem CID | 166807172 |
| Molecular Formula | C16H28N2O4S2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-methyl-N-[[1-[2-[2-oxo-2-(pent-2-ynylamino)ethoxy]ethoxy]ethyldisulfanyl]methyl]propanamide |
| SMILES | CCC#CCNC(=O)COCCOC(C)SSCNC(=O)C(C)C |
| InChI | InChI=1S/C16H28N2O4S2/c1-5-6-7-8-17-15(19)11-21-9-10-22-14(4)24-23-12-18-16(20)13(2)3/h13-14H,5,8-12H2,1-4H3,(H,17,19)(H,18,20) |
| InChIKey | MOWZNDAEZQMGNI-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|