C14H25NO3S2 — CID 169267178
2-[2-[1-(methyldisulfanyl)propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide (PubChem CID 169267178) has the molecular formula C14H25NO3S2 and a molecular weight of 319.49 g/mol. Its IUPAC name is 2-[2-[1-(methyldisulfanyl)propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide.
| Compound Name | 2-[2-[1-(methyldisulfanyl)propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide |
|---|---|
| PubChem CID | 169267178 |
| Molecular Formula | C14H25NO3S2 |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-[2-[1-(methyldisulfanyl)propoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide |
| SMILES | CCC(OCCOCC(=O)NCC#CC(C)C)SSC |
| InChI | InChI=1S/C14H25NO3S2/c1-5-14(20-19-4)18-10-9-17-11-13(16)15-8-6-7-12(2)3/h12,14H,5,8-11H2,1-4H3,(H,15,16) |
| InChIKey | DMTKJOIEQZYDQS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|