C27H45NO3S2Si — CID 174095385
2-[2-[1-[[4-(3-methylbutyl)phenyl]disulfanyl]-2-trimethylsilylpropoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide (PubChem CID 174095385) has the molecular formula C27H45NO3S2Si and a molecular weight of 523.88 g/mol. Its IUPAC name is 2-[2-[1-[[4-(3-methylbutyl)phenyl]disulfanyl]-2-trimethylsilylpropoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide.
| Compound Name | 2-[2-[1-[[4-(3-methylbutyl)phenyl]disulfanyl]-2-trimethylsilylpropoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide |
|---|---|
| PubChem CID | 174095385 |
| Molecular Formula | C27H45NO3S2Si |
| Molecular Weight | 523.88 g/mol |
| Exact Mass | 523.26 |
| IUPAC Name | 2-[2-[1-[[4-(3-methylbutyl)phenyl]disulfanyl]-2-trimethylsilylpropoxy]ethoxy]-N-(4-methylpent-2-ynyl)acetamide |
| SMILES | CC(C)C#CCNC(=O)COCCOC(SSc1ccc(CCC(C)C)cc1)C(C)[Si](C)(C)C |
| InChI | InChI=1S/C27H45NO3S2Si/c1-21(2)10-9-17-28-26(29)20-30-18-19-31-27(23(5)34(6,7)8)33-32-25-15-13-24(14-16-25)12-11-22(3)4/h13-16,21-23,27H,11-12,17-20H2,1-8H3,(H,28,29) |
| InChIKey | VGFZNQFMWYJNND-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.88 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|