C26H39NO4S2 — CID 163413309
4-[(methyldisulfanyl)-[2-(7-methyl-2-oxooct-5-ynoxy)ethoxy]methyl]-N-(4-methylpentyl)benzamide (PubChem CID 163413309) has the molecular formula C26H39NO4S2 and a molecular weight of 493.74 g/mol. Its IUPAC name is 4-[(methyldisulfanyl)-[2-(7-methyl-2-oxooct-5-ynoxy)ethoxy]methyl]-N-(4-methylpentyl)benzamide.
| Compound Name | 4-[(methyldisulfanyl)-[2-(7-methyl-2-oxooct-5-ynoxy)ethoxy]methyl]-N-(4-methylpentyl)benzamide |
|---|---|
| PubChem CID | 163413309 |
| Molecular Formula | C26H39NO4S2 |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 4-[(methyldisulfanyl)-[2-(7-methyl-2-oxooct-5-ynoxy)ethoxy]methyl]-N-(4-methylpentyl)benzamide |
| SMILES | CSSC(OCCOCC(=O)CCC#CC(C)C)c1ccc(C(=O)NCCCC(C)C)cc1 |
| InChI | InChI=1S/C26H39NO4S2/c1-20(2)9-6-7-11-24(28)19-30-17-18-31-26(33-32-5)23-14-12-22(13-15-23)25(29)27-16-8-10-21(3)4/h12-15,20-21,26H,7-8,10-11,16-19H2,1-5H3,(H,27,29) |
| InChIKey | KDMGYRBJLKYXOY-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|