C17H28N2O6S2 — CID 170184276
1-[2-ethoxyethoxy(sulfosulfanyl)methyl]-4-[2-(propan-2-ylamino)ethylcarbamoyl]benzene (PubChem CID 170184276) has the molecular formula C17H28N2O6S2 and a molecular weight of 420.55 g/mol. Its IUPAC name is 1-[2-ethoxyethoxy(sulfosulfanyl)methyl]-4-[2-(propan-2-ylamino)ethylcarbamoyl]benzene.
| Compound Name | 1-[2-ethoxyethoxy(sulfosulfanyl)methyl]-4-[2-(propan-2-ylamino)ethylcarbamoyl]benzene |
|---|---|
| PubChem CID | 170184276 |
| Molecular Formula | C17H28N2O6S2 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 1-[2-ethoxyethoxy(sulfosulfanyl)methyl]-4-[2-(propan-2-ylamino)ethylcarbamoyl]benzene |
| SMILES | CCOCCOC(SS(=O)(=O)O)c1ccc(C(=O)NCCNC(C)C)cc1 |
| InChI | InChI=1S/C17H28N2O6S2/c1-4-24-11-12-25-17(26-27(21,22)23)15-7-5-14(6-8-15)16(20)19-10-9-18-13(2)3/h5-8,13,17-18H,4,9-12H2,1-3H3,(H,19,20)(H,21,22,23) |
| InChIKey | BIFBZPYVLVEKJS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|