C16H26N2O5S — CID 55685376
4-(butan-2-ylsulfamoyl)-N-[2-(2-methoxyethoxy)ethyl]benzamide (PubChem CID 55685376) has the molecular formula C16H26N2O5S and a molecular weight of 358.46 g/mol. Its IUPAC name is 4-(butan-2-ylsulfamoyl)-N-[2-(2-methoxyethoxy)ethyl]benzamide.
| Compound Name | 4-(butan-2-ylsulfamoyl)-N-[2-(2-methoxyethoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 55685376 |
| Molecular Formula | C16H26N2O5S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-(butan-2-ylsulfamoyl)-N-[2-(2-methoxyethoxy)ethyl]benzamide |
| SMILES | CCC(C)NS(=O)(=O)c1ccc(C(=O)NCCOCCOC)cc1 |
| InChI | InChI=1S/C16H26N2O5S/c1-4-13(2)18-24(20,21)15-7-5-14(6-8-15)16(19)17-9-10-23-12-11-22-3/h5-8,13,18H,4,9-12H2,1-3H3,(H,17,19) |
| InChIKey | NVQNAEKVSXOKLX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|