C15H23N3O5S — CID 9224721
N-[2-(ethylamino)-2-oxoethyl]-4-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzamide (PubChem CID 9224721) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[2-(ethylamino)-2-oxoethyl]-4-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzamide.
| Compound Name | N-[2-(ethylamino)-2-oxoethyl]-4-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 9224721 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | N-[2-(ethylamino)-2-oxoethyl]-4-[[(2R)-1-methoxypropan-2-yl]sulfamoyl]benzamide |
| SMILES | CCNC(=O)CNC(=O)c1ccc(S(=O)(=O)N[C@H](C)COC)cc1 |
| InChI | InChI=1S/C15H23N3O5S/c1-4-16-14(19)9-17-15(20)12-5-7-13(8-6-12)24(21,22)18-11(2)10-23-3/h5-8,11,18H,4,9-10H2,1-3H3,(H,16,19)(H,17,20)/t11-/m1/s1 |
| InChIKey | AVLYJFJOMYDSNP-LLVKDONJSA-N |
| XLogP | -0.13 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |