C25H40N4O3S2 — CID 162478688
4-[[2-[2-(3-methylbut-1-ynylamino)-2-oxoethoxy]ethylamino]-(propan-2-yldisulfanyl)methyl]-N-[2-(propan-2-ylamino)ethyl]benzamide (PubChem CID 162478688) has the molecular formula C25H40N4O3S2 and a molecular weight of 508.75 g/mol. Its IUPAC name is 4-[[2-[2-(3-methylbut-1-ynylamino)-2-oxoethoxy]ethylamino]-(propan-2-yldisulfanyl)methyl]-N-[2-(propan-2-ylamino)ethyl]benzamide.
| Compound Name | 4-[[2-[2-(3-methylbut-1-ynylamino)-2-oxoethoxy]ethylamino]-(propan-2-yldisulfanyl)methyl]-N-[2-(propan-2-ylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 162478688 |
| Molecular Formula | C25H40N4O3S2 |
| Molecular Weight | 508.75 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 4-[[2-[2-(3-methylbut-1-ynylamino)-2-oxoethoxy]ethylamino]-(propan-2-yldisulfanyl)methyl]-N-[2-(propan-2-ylamino)ethyl]benzamide |
| SMILES | CC(C)C#CNC(=O)COCCNC(SSC(C)C)c1ccc(C(=O)NCCNC(C)C)cc1 |
| InChI | InChI=1S/C25H40N4O3S2/c1-18(2)11-12-27-23(30)17-32-16-15-29-25(34-33-20(5)6)22-9-7-21(8-10-22)24(31)28-14-13-26-19(3)4/h7-10,18-20,25-26,29H,13-17H2,1-6H3,(H,27,30)(H,28,31) |
| InChIKey | CTISBYXSHOYSNB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.75 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|