C18H36N2O4S2 — CID 166551905
2-methyl-N-[[2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]propan-2-yldisulfanyl]methyl]propanamide;molecular hydrogen (PubChem CID 166551905) has the molecular formula C18H36N2O4S2 and a molecular weight of 408.63 g/mol. Its IUPAC name is 2-methyl-N-[[2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]propan-2-yldisulfanyl]methyl]propanamide;molecular hydrogen.
| Compound Name | 2-methyl-N-[[2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]propan-2-yldisulfanyl]methyl]propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 166551905 |
| Molecular Formula | C18H36N2O4S2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 2-methyl-N-[[2-[2-[2-(4-methylpent-2-ynylamino)-2-oxoethoxy]ethoxy]propan-2-yldisulfanyl]methyl]propanamide;molecular hydrogen |
| SMILES | CC(C)C#CCNC(=O)COCCOC(C)(C)SSCNC(=O)C(C)C.[H][H].[H][H] |
| InChI | InChI=1S/C18H32N2O4S2.2H2/c1-14(2)8-7-9-19-16(21)12-23-10-11-24-18(5,6)26-25-13-20-17(22)15(3)4;;/h14-15H,9-13H2,1-6H3,(H,19,21)(H,20,22);2*1H |
| InChIKey | BZXXROOWRALJSF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|