C13H22N2O4S2 — CID 166551910
2-[2-[2-(acetamidomethyldisulfanyl)propan-2-yloxy]ethoxy]-N-prop-2-ynylacetamide (PubChem CID 166551910) has the molecular formula C13H22N2O4S2 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-[2-[2-(acetamidomethyldisulfanyl)propan-2-yloxy]ethoxy]-N-prop-2-ynylacetamide.
| Compound Name | 2-[2-[2-(acetamidomethyldisulfanyl)propan-2-yloxy]ethoxy]-N-prop-2-ynylacetamide |
|---|---|
| PubChem CID | 166551910 |
| Molecular Formula | C13H22N2O4S2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[2-[2-(acetamidomethyldisulfanyl)propan-2-yloxy]ethoxy]-N-prop-2-ynylacetamide |
| SMILES | C#CCNC(=O)COCCOC(C)(C)SSCNC(C)=O |
| InChI | InChI=1S/C13H22N2O4S2/c1-5-6-14-12(17)9-18-7-8-19-13(3,4)21-20-10-15-11(2)16/h1H,6-10H2,2-4H3,(H,14,17)(H,15,16) |
| InChIKey | ILANAIOTSCLJRL-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|