C22H46N2O4S2 — CID 169267105
N-but-2-ynyl-3-[2-[2-[2-[2-(ethylamino)ethyldisulfanyl]propan-2-yloxy]ethoxy]ethoxy]propanamide;ethane (PubChem CID 169267105) has the molecular formula C22H46N2O4S2 and a molecular weight of 466.75 g/mol. Its IUPAC name is N-but-2-ynyl-3-[2-[2-[2-[2-(ethylamino)ethyldisulfanyl]propan-2-yloxy]ethoxy]ethoxy]propanamide;ethane.
| Compound Name | N-but-2-ynyl-3-[2-[2-[2-[2-(ethylamino)ethyldisulfanyl]propan-2-yloxy]ethoxy]ethoxy]propanamide;ethane |
|---|---|
| PubChem CID | 169267105 |
| Molecular Formula | C22H46N2O4S2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | N-but-2-ynyl-3-[2-[2-[2-[2-(ethylamino)ethyldisulfanyl]propan-2-yloxy]ethoxy]ethoxy]propanamide;ethane |
| SMILES | CC.CC.CC#CCNC(=O)CCOCCOCCOC(C)(C)SSCCNCC |
| InChI | InChI=1S/C18H34N2O4S2.2C2H6/c1-5-7-9-20-17(21)8-11-22-12-13-23-14-15-24-18(3,4)26-25-16-10-19-6-2;2*1-2/h19H,6,8-16H2,1-4H3,(H,20,21);2*1-2H3 |
| InChIKey | TXUZNIUXFQPIAQ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|