C25H40N4O6S2 — CID 165135915
N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]-2-[4-[(4-methylpent-2-ynylcarbamoylamino)oxymethyldisulfanyl]phenyl]acetamide (PubChem CID 165135915) has the molecular formula C25H40N4O6S2 and a molecular weight of 556.75 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]-2-[4-[(4-methylpent-2-ynylcarbamoylamino)oxymethyldisulfanyl]phenyl]acetamide.
| Compound Name | N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]-2-[4-[(4-methylpent-2-ynylcarbamoylamino)oxymethyldisulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 165135915 |
| Molecular Formula | C25H40N4O6S2 |
| Molecular Weight | 556.75 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | N-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethyl]-2-[4-[(4-methylpent-2-ynylcarbamoylamino)oxymethyldisulfanyl]phenyl]acetamide |
| SMILES | CNCCOCCOCCOCCNC(=O)Cc1ccc(SSCONC(=O)NCC#CC(C)C)cc1 |
| InChI | InChI=1S/C25H40N4O6S2/c1-21(2)5-4-10-28-25(31)29-35-20-36-37-23-8-6-22(7-9-23)19-24(30)27-12-14-33-16-18-34-17-15-32-13-11-26-3/h6-9,21,26H,10-20H2,1-3H3,(H,27,30)(H2,28,29,31) |
| InChIKey | PVXJTPFHFPWXEB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 119.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|