C26H46N2O6S3 — CID 170184380
N-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethyl]-2-[4-[4-(1-sulfanylethoxy)butoxymethyldisulfanyl]phenyl]acetamide (PubChem CID 170184380) has the molecular formula C26H46N2O6S3 and a molecular weight of 578.86 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethyl]-2-[4-[4-(1-sulfanylethoxy)butoxymethyldisulfanyl]phenyl]acetamide.
| Compound Name | N-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethyl]-2-[4-[4-(1-sulfanylethoxy)butoxymethyldisulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 170184380 |
| Molecular Formula | C26H46N2O6S3 |
| Molecular Weight | 578.86 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | N-[2-[2-[2-[2-(propan-2-ylamino)ethoxy]ethoxy]ethoxy]ethyl]-2-[4-[4-(1-sulfanylethoxy)butoxymethyldisulfanyl]phenyl]acetamide |
| SMILES | CC(C)NCCOCCOCCOCCNC(=O)Cc1ccc(SSCOCCCCOC(C)S)cc1 |
| InChI | InChI=1S/C26H46N2O6S3/c1-22(2)27-10-14-30-16-18-32-19-17-31-15-11-28-26(29)20-24-6-8-25(9-7-24)37-36-21-33-12-4-5-13-34-23(3)35/h6-9,22-23,27,35H,4-5,10-21H2,1-3H3,(H,28,29) |
| InChIKey | HYJICWLBLXUGRK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 87.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|